ChemNet > CAS > 220227-37-2 3,4,5-trifluorobenzyl alcohol
220227-37-2 3,4,5-trifluorobenzyl alcohol
produktnavn |
3,4,5-trifluorobenzyl alcohol |
Synonymer |
3,4,5-trifluorobenzenemethanol; (3,4,5-trifluorophenyl)methanol |
Molekylær Formel |
C7H5F3O |
Molekylvekt |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2,11H,3H2 |
CAS-nummer |
220227-37-2 |
Molecular Structure |
|
Tetthet |
1.398g/cm3 |
Kokepunkt |
192.1°C at 760 mmHg |
Brytningsindeks |
1.476 |
Flammepunktet |
83°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|